About 2H-isoindole;1H-pyrrole
2H-isoindole;1H-pyrrole (PubChem CID 162096174) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2H-isoindole;1H-pyrrole.
Molecular Properties
| Compound Name | 2H-isoindole;1H-pyrrole |
| PubChem CID | 162096174 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2H-isoindole;1H-pyrrole |
| SMILES | c1cc[nH]c1.c1ccc2c[nH]cc2c1 |
| InChI | InChI=1S/C8H7N.C4H5N/c1-2-4-8-6-9-5-7(8)3-1;1-2-4-5-3-1/h1-6,9H;1-5H |
| InChIKey | ZEGSMSJHSNKRIZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2H-isoindole;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-isoindole;1H-pyrrole?
The IUPAC name of 2H-isoindole;1H-pyrrole (CID 162096174) is 2H-isoindole;1H-pyrrole.
What is the SMILES notation for 2H-isoindole;1H-pyrrole?
The canonical SMILES for 2H-isoindole;1H-pyrrole is c1cc[nH]c1.c1ccc2c[nH]cc2c1.
What is the InChIKey of 2H-isoindole;1H-pyrrole?
The InChIKey is ZEGSMSJHSNKRIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C4H5N/c1-2-4-8-6-9-5-7(8)3-1;1-2-4-5-3-1/h1-6,9H;1-5H.
What are the key properties of 2H-isoindole;1H-pyrrole?
2H-isoindole;1H-pyrrole has a molecular weight of 184.24 g/mol, XLogP of 3.18, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-isoindole;1H-pyrrole is sourced from PubChem (CID 162096174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).