About 9H-carbazole;2H-isoindole
9H-carbazole;2H-isoindole (PubChem CID 159442064) has the molecular formula C20H16N2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 9H-carbazole;2H-isoindole.
Molecular Properties
| Compound Name | 9H-carbazole;2H-isoindole |
| PubChem CID | 159442064 |
| Molecular Formula | C20H16N2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 9H-carbazole;2H-isoindole |
| SMILES | c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c[nH]cc2c1 |
| InChI | InChI=1S/C12H9N.C8H7N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-4-8-6-9-5-7(8)3-1/h1-8,13H;1-6,9H |
| InChIKey | LSHHYTYLJPONMG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-carbazole;2H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;2H-isoindole?
The IUPAC name of 9H-carbazole;2H-isoindole (CID 159442064) is 9H-carbazole;2H-isoindole.
What is the SMILES notation for 9H-carbazole;2H-isoindole?
The canonical SMILES for 9H-carbazole;2H-isoindole is c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c[nH]cc2c1.
What is the InChIKey of 9H-carbazole;2H-isoindole?
The InChIKey is LSHHYTYLJPONMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C8H7N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-4-8-6-9-5-7(8)3-1/h1-8,13H;1-6,9H.
What are the key properties of 9H-carbazole;2H-isoindole?
9H-carbazole;2H-isoindole has a molecular weight of 284.36 g/mol, XLogP of 5.49, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;2H-isoindole is sourced from PubChem (CID 159442064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).