C16H13N — CID 54026557
10-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene (PubChem CID 54026557) has the molecular formula C16H13N and a molecular weight of 219.29 g/mol. Its IUPAC name is 10-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene.
| Compound Name | 10-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 54026557 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 10-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene |
| SMILES | c1ccc2c(c1)cc[nH]ccc1ccccc12 |
| InChI | InChI=1S/C16H13N/c1-3-7-15-13(5-1)9-11-17-12-10-14-6-2-4-8-16(14)15/h1-12,17H/b11-9-,12-10- |
| InChIKey | LCOWJZPBRQNZKB-HWAYABPNSA-N |
| XLogP | 4.45 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |