C16H11N — CID 142747457
2H-naphtho[2,1-e]isoindole (PubChem CID 142747457) has the molecular formula C16H11N and a molecular weight of 217.27 g/mol. Its IUPAC name is 2H-naphtho[2,1-e]isoindole.
| Compound Name | 2H-naphtho[2,1-e]isoindole |
|---|---|
| PubChem CID | 142747457 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2H-naphtho[2,1-e]isoindole |
| SMILES | c1ccc2c(c1)ccc1c3c[nH]cc3ccc21 |
| InChI | InChI=1S/C16H11N/c1-2-4-13-11(3-1)5-7-15-14(13)8-6-12-9-17-10-16(12)15/h1-10,17H |
| InChIKey | FMAZXBUTOUERME-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|