About azane;1-phenylethanone;1H-pyrrole
azane;1-phenylethanone;1H-pyrrole (PubChem CID 174731229) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is azane;1-phenylethanone;1H-pyrrole.
Molecular Properties
| Compound Name | azane;1-phenylethanone;1H-pyrrole |
| PubChem CID | 174731229 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | azane;1-phenylethanone;1H-pyrrole |
| SMILES | CC(=O)c1ccccc1.N.c1cc[nH]c1 |
| InChI | InChI=1S/C8H8O.C4H5N.H3N/c1-7(9)8-5-3-2-4-6-8;1-2-4-5-3-1;/h2-6H,1H3;1-5H;1H3 |
| InChIKey | JDYZWXMSQXKPPM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1-phenylethanone;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-phenylethanone;1H-pyrrole?
The IUPAC name of azane;1-phenylethanone;1H-pyrrole (CID 174731229) is azane;1-phenylethanone;1H-pyrrole.
What is the SMILES notation for azane;1-phenylethanone;1H-pyrrole?
The canonical SMILES for azane;1-phenylethanone;1H-pyrrole is CC(=O)c1ccccc1.N.c1cc[nH]c1.
What is the InChIKey of azane;1-phenylethanone;1H-pyrrole?
The InChIKey is JDYZWXMSQXKPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C4H5N.H3N/c1-7(9)8-5-3-2-4-6-8;1-2-4-5-3-1;/h2-6H,1H3;1-5H;1H3.
What are the key properties of azane;1-phenylethanone;1H-pyrrole?
azane;1-phenylethanone;1H-pyrrole has a molecular weight of 204.27 g/mol, XLogP of 3.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-phenylethanone;1H-pyrrole is sourced from PubChem (CID 174731229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).