C12H9F6IN2O2 — CID 161346597
1H-pyridin-2-one;trifluoro(iodo)methane;3-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 161346597) has the molecular formula C12H9F6IN2O2 and a molecular weight of 454.11 g/mol. Its IUPAC name is 1H-pyridin-2-one;trifluoro(iodo)methane;3-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 1H-pyridin-2-one;trifluoro(iodo)methane;3-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 161346597 |
| Molecular Formula | C12H9F6IN2O2 |
| Molecular Weight | 454.11 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 1H-pyridin-2-one;trifluoro(iodo)methane;3-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | FC(F)(F)I.O=c1[nH]cccc1C(F)(F)F.O=c1cccc[nH]1 |
| InChI | InChI=1S/C6H4F3NO.C5H5NO.CF3I/c7-6(8,9)4-2-1-3-10-5(4)11;7-5-3-1-2-4-6-5;2-1(3,4)5/h1-3H,(H,10,11);1-4H,(H,6,7); |
| InChIKey | VNJMWPIIHCOFCR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|