C21H16F3N3O — CID 161346930
4-methyl-1-(pyridin-2-ylmethyl)-5-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyridin-2-one (PubChem CID 161346930) has the molecular formula C21H16F3N3O and a molecular weight of 383.37 g/mol. Its IUPAC name is 4-methyl-1-(pyridin-2-ylmethyl)-5-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyridin-2-one.
| Compound Name | 4-methyl-1-(pyridin-2-ylmethyl)-5-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyridin-2-one |
|---|---|
| PubChem CID | 161346930 |
| Molecular Formula | C21H16F3N3O |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-methyl-1-(pyridin-2-ylmethyl)-5-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyridin-2-one |
| SMILES | Cc1cc(=O)n(Cc2ccccn2)cc1-c1cc(C(F)(F)F)cc2c1C=NC2 |
| InChI | InChI=1S/C21H16F3N3O/c1-13-6-20(28)27(11-16-4-2-3-5-26-16)12-19(13)17-8-15(21(22,23)24)7-14-9-25-10-18(14)17/h2-8,10,12H,9,11H2,1H3 |
| InChIKey | VNKUQEPWVZIDPN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |