C21H24N4O — CID 161353773
1-[4-[8-(butylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]-2-cyclopropylethanone (PubChem CID 161353773) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[4-[8-(butylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]-2-cyclopropylethanone.
| Compound Name | 1-[4-[8-(butylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 161353773 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[4-[8-(butylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]-2-cyclopropylethanone |
| SMILES | CCCCNc1nccn2c(-c3ccc(C(=O)CC4CC4)cc3)cnc12 |
| InChI | InChI=1S/C21H24N4O/c1-2-3-10-22-20-21-24-14-18(25(21)12-11-23-20)16-6-8-17(9-7-16)19(26)13-15-4-5-15/h6-9,11-12,14-15H,2-5,10,13H2,1H3,(H,22,23) |
| InChIKey | VOGMIJQNIUFJEY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|