C18H20N4O2 — CID 126474461
1-[3-[8-(3-methoxypropylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]ethanone (PubChem CID 126474461) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[3-[8-(3-methoxypropylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]ethanone.
| Compound Name | 1-[3-[8-(3-methoxypropylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 126474461 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[3-[8-(3-methoxypropylamino)imidazo[1,2-a]pyrazin-3-yl]phenyl]ethanone |
| SMILES | COCCCNc1nccn2c(-c3cccc(C(C)=O)c3)cnc12 |
| InChI | InChI=1S/C18H20N4O2/c1-13(23)14-5-3-6-15(11-14)16-12-21-18-17(19-7-4-10-24-2)20-8-9-22(16)18/h3,5-6,8-9,11-12H,4,7,10H2,1-2H3,(H,19,20) |
| InChIKey | DNLZRADLCJGJAO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|