About [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane
[(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane (PubChem CID 161360280) has the molecular formula C14H30NNiO4
and a molecular weight of 335.09 g/mol. Its IUPAC name is [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane.
Molecular Properties
| Compound Name | [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane |
| PubChem CID | 161360280 |
| Molecular Formula | C14H30NNiO4 |
| Molecular Weight | 335.09 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane |
| SMILES | CC(C)C[C@@H](C[CH-][OH+][O-])C[N+](=O)[O-].[CH2-]CC.[CH2-]CC.[Ni+3] |
| InChI | InChI=1S/C8H16NO4.2C3H7.Ni/c1-7(2)5-8(3-4-13-12)6-9(10)11;2*1-3-2;/h4,7-8,13H,3,5-6H2,1-2H3;2*1,3H2,2H3;/q3*-1;+3/t8-;;;/m1.../s1 |
| InChIKey | XEWQLEKBMPMIRE-VFIYQRISSA-N |
| XLogP | 3.30 |
| TPSA | 79.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.09 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane?
The IUPAC name of [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane (CID 161360280) is [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane.
What is the SMILES notation for [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane?
The canonical SMILES for [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane is CC(C)C[C@@H](C[CH-][OH+][O-])C[N+](=O)[O-].[CH2-]CC.[CH2-]CC.[Ni+3].
What is the InChIKey of [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane?
The InChIKey is XEWQLEKBMPMIRE-VFIYQRISSA-N. The full InChI is InChI=1S/C8H16NO4.2C3H7.Ni/c1-7(2)5-8(3-4-13-12)6-9(10)11;2*1-3-2;/h4,7-8,13H,3,5-6H2,1-2H3;2*1,3H2,2H3;/q3*-1;+3/t8-;;;/m1.../s1.
What are the key properties of [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane?
[(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane has a molecular weight of 335.09 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-5-methyl-3-(nitromethyl)hexyl]-oxidooxidanium;nickel(3+);propane is sourced from PubChem (CID 161360280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).