C14H30N4O4 — CID 139855095
N,N'-bis(2-methyl-3-nitropropyl)hexane-1,6-diamine (PubChem CID 139855095) has the molecular formula C14H30N4O4 and a molecular weight of 318.42 g/mol. Its IUPAC name is N,N'-bis(2-methyl-3-nitropropyl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(2-methyl-3-nitropropyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 139855095 |
| Molecular Formula | C14H30N4O4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N,N'-bis(2-methyl-3-nitropropyl)hexane-1,6-diamine |
| SMILES | CC(CNCCCCCCNCC(C)C[N+](=O)[O-])C[N+](=O)[O-] |
| InChI | InChI=1S/C14H30N4O4/c1-13(11-17(19)20)9-15-7-5-3-4-6-8-16-10-14(2)12-18(21)22/h13-16H,3-12H2,1-2H3 |
| InChIKey | AQZMNDTVCAGBCS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|