C17H36N4O4 — CID 19838348
N,N'-bis(3-methyl-3-nitrobutyl)heptane-1,7-diamine (PubChem CID 19838348) has the molecular formula C17H36N4O4 and a molecular weight of 360.50 g/mol. Its IUPAC name is N,N'-bis(3-methyl-3-nitrobutyl)heptane-1,7-diamine.
| Compound Name | N,N'-bis(3-methyl-3-nitrobutyl)heptane-1,7-diamine |
|---|---|
| PubChem CID | 19838348 |
| Molecular Formula | C17H36N4O4 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | N,N'-bis(3-methyl-3-nitrobutyl)heptane-1,7-diamine |
| SMILES | CC(C)(CCNCCCCCCCNCCC(C)(C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C17H36N4O4/c1-16(2,20(22)23)10-14-18-12-8-6-5-7-9-13-19-15-11-17(3,4)21(24)25/h18-19H,5-15H2,1-4H3 |
| InChIKey | INPVWVPGHMOGIH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|