C13H28N4O4 — CID 19838353
N,N'-bis(2-methyl-2-nitropropyl)pentane-1,5-diamine (PubChem CID 19838353) has the molecular formula C13H28N4O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is N,N'-bis(2-methyl-2-nitropropyl)pentane-1,5-diamine.
| Compound Name | N,N'-bis(2-methyl-2-nitropropyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 19838353 |
| Molecular Formula | C13H28N4O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | N,N'-bis(2-methyl-2-nitropropyl)pentane-1,5-diamine |
| SMILES | CC(C)(CNCCCCCNCC(C)(C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C13H28N4O4/c1-12(2,16(18)19)10-14-8-6-5-7-9-15-11-13(3,4)17(20)21/h14-15H,5-11H2,1-4H3 |
| InChIKey | UHRBLJMODKPJAA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|