C30H46N2O6 — CID 161363033
2,6-dimethylmorpholine;1-(2,6-dimethylmorpholin-4-yl)-3-phenoxypropan-2-ol;2-(phenoxymethyl)oxirane (PubChem CID 161363033) has the molecular formula C30H46N2O6 and a molecular weight of 530.71 g/mol. Its IUPAC name is 2,6-dimethylmorpholine;1-(2,6-dimethylmorpholin-4-yl)-3-phenoxypropan-2-ol;2-(phenoxymethyl)oxirane.
| Compound Name | 2,6-dimethylmorpholine;1-(2,6-dimethylmorpholin-4-yl)-3-phenoxypropan-2-ol;2-(phenoxymethyl)oxirane |
|---|---|
| PubChem CID | 161363033 |
| Molecular Formula | C30H46N2O6 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2,6-dimethylmorpholine;1-(2,6-dimethylmorpholin-4-yl)-3-phenoxypropan-2-ol;2-(phenoxymethyl)oxirane |
| SMILES | CC1CN(CC(O)COc2ccccc2)CC(C)O1.CC1CNCC(C)O1.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C15H23NO3.C9H10O2.C6H13NO/c1-12-8-16(9-13(2)19-12)10-14(17)11-18-15-6-4-3-5-7-15;1-2-4-8(5-3-1)10-6-9-7-11-9;1-5-3-7-4-6(2)8-5/h3-7,12-14,17H,8-11H2,1-2H3;1-5,9H,6-7H2;5-7H,3-4H2,1-2H3 |
| InChIKey | VPLAYZWYRATPDC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|