C29H45B2N3O2 — CID 161363656
CID 161363656 (PubChem CID 161363656) has the molecular formula C29H45B2N3O2 and a molecular weight of 489.32 g/mol.
| Compound Name | CID 161363656 |
|---|---|
| PubChem CID | 161363656 |
| Molecular Formula | C29H45B2N3O2 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 489.37 |
| IUPAC Name | — |
| SMILES | CC.CC.CC(C)c1cccc(C(=O)N2C[B]CC2)c1.CC(C)c1cccc(C(=O)N2C[B]CC2)n1 |
| InChI | InChI=1S/C13H17BNO.C12H16BN2O.2C2H6/c1-10(2)11-4-3-5-12(8-11)13(16)15-7-6-14-9-15;1-9(2)10-4-3-5-11(14-10)12(16)15-7-6-13-8-15;2*1-2/h3-5,8,10H,6-7,9H2,1-2H3;3-5,9H,6-8H2,1-2H3;2*1-2H3 |
| InChIKey | QOCQZMWQMQXHBM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|