C22H20ClNaO10S2 — CID 161365919
sodium;4-(4-chlorosulfonylphenoxy)but-2-ynyl acetate;4-(4-hydroxybut-2-ynoxy)benzenesulfonate (PubChem CID 161365919) has the molecular formula C22H20ClNaO10S2 and a molecular weight of 566.97 g/mol. Its IUPAC name is sodium;4-(4-chlorosulfonylphenoxy)but-2-ynyl acetate;4-(4-hydroxybut-2-ynoxy)benzenesulfonate.
| Compound Name | sodium;4-(4-chlorosulfonylphenoxy)but-2-ynyl acetate;4-(4-hydroxybut-2-ynoxy)benzenesulfonate |
|---|---|
| PubChem CID | 161365919 |
| Molecular Formula | C22H20ClNaO10S2 |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | sodium;4-(4-chlorosulfonylphenoxy)but-2-ynyl acetate;4-(4-hydroxybut-2-ynoxy)benzenesulfonate |
| SMILES | CC(=O)OCC#CCOc1ccc(S(=O)(=O)Cl)cc1.O=S(=O)([O-])c1ccc(OCC#CCO)cc1.[Na+] |
| InChI | InChI=1S/C12H11ClO5S.C10H10O5S.Na/c1-10(14)17-8-2-3-9-18-11-4-6-12(7-5-11)19(13,15)16;11-7-1-2-8-15-9-3-5-10(6-4-9)16(12,13)14;/h4-7H,8-9H2,1H3;3-6,11H,7-8H2,(H,12,13,14);/q;;+1/p-1 |
| InChIKey | VPUPVCQFNQGKKR-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 156.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|