C21H37B2N7O5 — CID 161367827
CID 161367827 (PubChem CID 161367827) has the molecular formula C21H37B2N7O5 and a molecular weight of 489.20 g/mol.
| Compound Name | CID 161367827 |
|---|---|
| PubChem CID | 161367827 |
| Molecular Formula | C21H37B2N7O5 |
| Molecular Weight | 489.20 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | — |
| SMILES | [B]=NCC(=O)N(CCNC)CC(=O)NC(C)CCCC(=O)NC(C)CN(CC(C)=O)C(=O)CN=[B] |
| InChI | InChI=1S/C21H37B2N7O5/c1-15(27-19(33)14-29(9-8-24-4)20(34)10-25-22)6-5-7-18(32)28-16(2)12-30(13-17(3)31)21(35)11-26-23/h15-16,24H,5-14H2,1-4H3,(H,27,33)(H,28,32) |
| InChIKey | BIGXATCEJFONRB-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 152.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.20 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|