C17H33N3O4 — CID 155744507
5-[[2-[ethyl(propanoyl)amino]acetyl]amino]-N-(3-hydroxybutyl)hexanamide (PubChem CID 155744507) has the molecular formula C17H33N3O4 and a molecular weight of 343.47 g/mol. Its IUPAC name is 5-[[2-[ethyl(propanoyl)amino]acetyl]amino]-N-(3-hydroxybutyl)hexanamide.
| Compound Name | 5-[[2-[ethyl(propanoyl)amino]acetyl]amino]-N-(3-hydroxybutyl)hexanamide |
|---|---|
| PubChem CID | 155744507 |
| Molecular Formula | C17H33N3O4 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 5-[[2-[ethyl(propanoyl)amino]acetyl]amino]-N-(3-hydroxybutyl)hexanamide |
| SMILES | CCC(=O)N(CC)CC(=O)NC(C)CCCC(=O)NCCC(C)O |
| InChI | InChI=1S/C17H33N3O4/c1-5-17(24)20(6-2)12-16(23)19-13(3)8-7-9-15(22)18-11-10-14(4)21/h13-14,21H,5-12H2,1-4H3,(H,18,22)(H,19,23) |
| InChIKey | HWTIFPVJOZOUTC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |