About calcium;dihydrogen phosphite;nitrate
calcium;dihydrogen phosphite;nitrate (PubChem CID 161369955) has the molecular formula H2CaNO6P
and a molecular weight of 183.07 g/mol. Its IUPAC name is calcium;dihydrogen phosphite;nitrate.
Molecular Properties
| Compound Name | calcium;dihydrogen phosphite;nitrate |
| PubChem CID | 161369955 |
| Molecular Formula | H2CaNO6P |
| Molecular Weight | 183.07 g/mol |
| Exact Mass | 182.92 |
| IUPAC Name | calcium;dihydrogen phosphite;nitrate |
| SMILES | O=[N+]([O-])[O-].[Ca+2].[O-]P(O)O |
| InChI | InChI=1S/Ca.NO3.H2O3P/c;2-1(3)4;1-4(2)3/h;;1-2H/q+2;2*-1 |
| InChIKey | VQIFOWUKCWDVOF-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.07 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;dihydrogen phosphite;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;dihydrogen phosphite;nitrate?
The IUPAC name of calcium;dihydrogen phosphite;nitrate (CID 161369955) is calcium;dihydrogen phosphite;nitrate.
What is the SMILES notation for calcium;dihydrogen phosphite;nitrate?
The canonical SMILES for calcium;dihydrogen phosphite;nitrate is O=[N+]([O-])[O-].[Ca+2].[O-]P(O)O.
What is the InChIKey of calcium;dihydrogen phosphite;nitrate?
The InChIKey is VQIFOWUKCWDVOF-UHFFFAOYSA-N. The full InChI is InChI=1S/Ca.NO3.H2O3P/c;2-1(3)4;1-4(2)3/h;;1-2H/q+2;2*-1.
What are the key properties of calcium;dihydrogen phosphite;nitrate?
calcium;dihydrogen phosphite;nitrate has a molecular weight of 183.07 g/mol, XLogP of -2.06, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;dihydrogen phosphite;nitrate is sourced from PubChem (CID 161369955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).