About potassium;dihydrogen phosphite;nitric acid
potassium;dihydrogen phosphite;nitric acid (PubChem CID 172776664) has the molecular formula H3KNO6P
and a molecular weight of 183.10 g/mol. Its IUPAC name is potassium;dihydrogen phosphite;nitric acid.
Molecular Properties
| Compound Name | potassium;dihydrogen phosphite;nitric acid |
| PubChem CID | 172776664 |
| Molecular Formula | H3KNO6P |
| Molecular Weight | 183.10 g/mol |
| Exact Mass | 182.93 |
| IUPAC Name | potassium;dihydrogen phosphite;nitric acid |
| SMILES | O=[N+]([O-])O.[K+].[O-]P(O)O |
| InChI | InChI=1S/K.HNO3.H2O3P/c;2-1(3)4;1-4(2)3/h;(H,2,3,4);1-2H/q+1;;-1 |
| InChIKey | NRMUUZPQFLOZLN-UHFFFAOYSA-N |
| XLogP | -4.79 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.10 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;dihydrogen phosphite;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;dihydrogen phosphite;nitric acid?
The IUPAC name of potassium;dihydrogen phosphite;nitric acid (CID 172776664) is potassium;dihydrogen phosphite;nitric acid.
What is the SMILES notation for potassium;dihydrogen phosphite;nitric acid?
The canonical SMILES for potassium;dihydrogen phosphite;nitric acid is O=[N+]([O-])O.[K+].[O-]P(O)O.
What is the InChIKey of potassium;dihydrogen phosphite;nitric acid?
The InChIKey is NRMUUZPQFLOZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/K.HNO3.H2O3P/c;2-1(3)4;1-4(2)3/h;(H,2,3,4);1-2H/q+1;;-1.
What are the key properties of potassium;dihydrogen phosphite;nitric acid?
potassium;dihydrogen phosphite;nitric acid has a molecular weight of 183.10 g/mol, XLogP of -4.79, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;dihydrogen phosphite;nitric acid is sourced from PubChem (CID 172776664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).