C22H19Br2NO — CID 161376953
(1E,3E)-1,3-bis[(4-bromophenyl)methylidene]-7-azaspiro[3.5]nonan-2-one (PubChem CID 161376953) has the molecular formula C22H19Br2NO and a molecular weight of 473.21 g/mol. Its IUPAC name is (1E,3E)-1,3-bis[(4-bromophenyl)methylidene]-7-azaspiro[3.5]nonan-2-one.
| Compound Name | (1E,3E)-1,3-bis[(4-bromophenyl)methylidene]-7-azaspiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 161376953 |
| Molecular Formula | C22H19Br2NO |
| Molecular Weight | 473.21 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | (1E,3E)-1,3-bis[(4-bromophenyl)methylidene]-7-azaspiro[3.5]nonan-2-one |
| SMILES | O=C1/C(=C/c2ccc(Br)cc2)C2(CCNCC2)/C1=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H19Br2NO/c23-17-5-1-15(2-6-17)13-19-21(26)20(22(19)9-11-25-12-10-22)14-16-3-7-18(24)8-4-16/h1-8,13-14,25H,9-12H2/b19-13-,20-14- |
| InChIKey | GJMGUXQLYMFILI-AXPXABNXSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.21 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|