C18H18BrN — CID 122492124
2-bromo-7-methylspiro[fluorene-9,4'-piperidine] (PubChem CID 122492124) has the molecular formula C18H18BrN and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-bromo-7-methylspiro[fluorene-9,4'-piperidine].
| Compound Name | 2-bromo-7-methylspiro[fluorene-9,4'-piperidine] |
|---|---|
| PubChem CID | 122492124 |
| Molecular Formula | C18H18BrN |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-bromo-7-methylspiro[fluorene-9,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)C1(CCNCC1)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C18H18BrN/c1-12-2-4-14-15-5-3-13(19)11-17(15)18(16(14)10-12)6-8-20-9-7-18/h2-5,10-11,20H,6-9H2,1H3 |
| InChIKey | DUZFXAHKFOZZJV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |