C22H16Br4 — CID 10651210
2,7,9-tribromo-9-[bromo-(2,5-dimethylphenyl)methyl]fluorene (PubChem CID 10651210) has the molecular formula C22H16Br4 and a molecular weight of 599.99 g/mol. Its IUPAC name is 2,7,9-tribromo-9-[bromo-(2,5-dimethylphenyl)methyl]fluorene.
| Compound Name | 2,7,9-tribromo-9-[bromo-(2,5-dimethylphenyl)methyl]fluorene |
|---|---|
| PubChem CID | 10651210 |
| Molecular Formula | C22H16Br4 |
| Molecular Weight | 599.99 g/mol |
| Exact Mass | 595.80 |
| IUPAC Name | 2,7,9-tribromo-9-[bromo-(2,5-dimethylphenyl)methyl]fluorene |
| SMILES | Cc1ccc(C)c(C(Br)C2(Br)c3cc(Br)ccc3-c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C22H16Br4/c1-12-3-4-13(2)18(9-12)21(25)22(26)19-10-14(23)5-7-16(19)17-8-6-15(24)11-20(17)22/h3-11,21H,1-2H3 |
| InChIKey | YFWHFZLRKVYCTA-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.99 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|