C27H20N2 — CID 161377659
10-[4-(4-isocyanophenyl)phenyl]-9-methyl-9H-acridine (PubChem CID 161377659) has the molecular formula C27H20N2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 10-[4-(4-isocyanophenyl)phenyl]-9-methyl-9H-acridine.
| Compound Name | 10-[4-(4-isocyanophenyl)phenyl]-9-methyl-9H-acridine |
|---|---|
| PubChem CID | 161377659 |
| Molecular Formula | C27H20N2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 10-[4-(4-isocyanophenyl)phenyl]-9-methyl-9H-acridine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(N3c4ccccc4C(C)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C27H20N2/c1-19-24-7-3-5-9-26(24)29(27-10-6-4-8-25(19)27)23-17-13-21(14-18-23)20-11-15-22(28-2)16-12-20/h3-19H,1H3 |
| InChIKey | YLEVKLIUPWJGQO-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|