C28H31BrN4O6 — CID 161392334
ethyl 2-[4-(bromomethyl)-1-oxophthalazin-2-yl]propanoate;ethyl 2-(4-methyl-1-oxophthalazin-2-yl)propanoate (PubChem CID 161392334) has the molecular formula C28H31BrN4O6 and a molecular weight of 599.48 g/mol. Its IUPAC name is ethyl 2-[4-(bromomethyl)-1-oxophthalazin-2-yl]propanoate;ethyl 2-(4-methyl-1-oxophthalazin-2-yl)propanoate.
| Compound Name | ethyl 2-[4-(bromomethyl)-1-oxophthalazin-2-yl]propanoate;ethyl 2-(4-methyl-1-oxophthalazin-2-yl)propanoate |
|---|---|
| PubChem CID | 161392334 |
| Molecular Formula | C28H31BrN4O6 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | ethyl 2-[4-(bromomethyl)-1-oxophthalazin-2-yl]propanoate;ethyl 2-(4-methyl-1-oxophthalazin-2-yl)propanoate |
| SMILES | CCOC(=O)C(C)n1nc(C)c2ccccc2c1=O.CCOC(=O)C(C)n1nc(CBr)c2ccccc2c1=O |
| InChI | InChI=1S/C14H15BrN2O3.C14H16N2O3/c1-3-20-14(19)9(2)17-13(18)11-7-5-4-6-10(11)12(8-15)16-17;1-4-19-14(18)10(3)16-13(17)12-8-6-5-7-11(12)9(2)15-16/h4-7,9H,3,8H2,1-2H3;5-8,10H,4H2,1-3H3 |
| InChIKey | VTDMUFJSCOIGDV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 122.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|