C13H16N2O5 — CID 161394230
(3S,4R)-3-(5-methoxy-2-pyridinyl)piperidine-1,4-dicarboxylic acid (PubChem CID 161394230) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3S,4R)-3-(5-methoxy-2-pyridinyl)piperidine-1,4-dicarboxylic acid.
| Compound Name | (3S,4R)-3-(5-methoxy-2-pyridinyl)piperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 161394230 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3S,4R)-3-(5-methoxy-2-pyridinyl)piperidine-1,4-dicarboxylic acid |
| SMILES | COc1ccc([C@@H]2CN(C(=O)O)CC[C@H]2C(=O)O)nc1 |
| InChI | InChI=1S/C13H16N2O5/c1-20-8-2-3-11(14-6-8)10-7-15(13(18)19)5-4-9(10)12(16)17/h2-3,6,9-10H,4-5,7H2,1H3,(H,16,17)(H,18,19)/t9-,10-/m1/s1 |
| InChIKey | VTJNQTFIMDYQIS-NXEZZACHSA-N |
| XLogP | 1.26 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |