About 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid
3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid (PubChem CID 91162502) has the molecular formula C16H16F3NO6
and a molecular weight of 375.30 g/mol. Its IUPAC name is 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid |
| PubChem CID | 91162502 |
| Molecular Formula | C16H16F3NO6 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid |
| SMILES | COC(=O)c1cc(C(F)(F)F)ccc1C1CN(C(=O)O)CCC1C(=O)O |
| InChI | InChI=1S/C16H16F3NO6/c1-26-14(23)11-6-8(16(17,18)19)2-3-9(11)12-7-20(15(24)25)5-4-10(12)13(21)22/h2-3,6,10,12H,4-5,7H2,1H3,(H,21,22)(H,24,25) |
| InChIKey | SZDFKKHBIMDWBS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid?
The IUPAC name of 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid (CID 91162502) is 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid.
What is the SMILES notation for 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid?
The canonical SMILES for 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid is COC(=O)c1cc(C(F)(F)F)ccc1C1CN(C(=O)O)CCC1C(=O)O.
What is the InChIKey of 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid?
The InChIKey is SZDFKKHBIMDWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3NO6/c1-26-14(23)11-6-8(16(17,18)19)2-3-9(11)12-7-20(15(24)25)5-4-10(12)13(21)22/h2-3,6,10,12H,4-5,7H2,1H3,(H,21,22)(H,24,25).
What are the key properties of 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid?
3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid has a molecular weight of 375.30 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methoxycarbonyl-4-(trifluoromethyl)phenyl]piperidine-1,4-dicarboxylic acid is sourced from PubChem (CID 91162502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).