C19H22N2O2 — CID 95846969
1-[(3R)-3-[5-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone (PubChem CID 95846969) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[(3R)-3-[5-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-[5-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95846969 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[(3R)-3-[5-(4-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(-c2ccc([C@@H]3CCCN(C(C)=O)C3)nc2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-14(22)21-11-3-4-17(13-21)19-10-7-16(12-20-19)15-5-8-18(23-2)9-6-15/h5-10,12,17H,3-4,11,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | RPLPOXHMZXGURT-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |