C23H17NO3 — CID 161394497
methyl 2-(3H-inden-1-yl)-3-oxo-1H-benzo[f]indole-2-carboxylate (PubChem CID 161394497) has the molecular formula C23H17NO3 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 2-(3H-inden-1-yl)-3-oxo-1H-benzo[f]indole-2-carboxylate.
| Compound Name | methyl 2-(3H-inden-1-yl)-3-oxo-1H-benzo[f]indole-2-carboxylate |
|---|---|
| PubChem CID | 161394497 |
| Molecular Formula | C23H17NO3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | methyl 2-(3H-inden-1-yl)-3-oxo-1H-benzo[f]indole-2-carboxylate |
| SMILES | COC(=O)C1(C2=CCc3ccccc32)Nc2cc3ccccc3cc2C1=O |
| InChI | InChI=1S/C23H17NO3/c1-27-22(26)23(19-11-10-14-6-4-5-9-17(14)19)21(25)18-12-15-7-2-3-8-16(15)13-20(18)24-23/h2-9,11-13,24H,10H2,1H3 |
| InChIKey | LPINWJFNFFCZIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|