About carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one
carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one (PubChem CID 161397937) has the molecular formula C13H13F2NO4
and a molecular weight of 285.25 g/mol. Its IUPAC name is carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one.
Molecular Properties
| Compound Name | carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one |
| PubChem CID | 161397937 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one |
| SMILES | CON1C[C@@H](c2c(F)cc(C)cc2F)CC1=O.O=C=O |
| InChI | InChI=1S/C12H13F2NO2.CO2/c1-7-3-9(13)12(10(14)4-7)8-5-11(16)15(6-8)17-2;2-1-3/h3-4,8H,5-6H2,1-2H3;/t8-;/m0./s1 |
| InChIKey | VTVVHIINXBOXDH-QRPNPIFTSA-N |
| XLogP | 1.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one?
The IUPAC name of carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one (CID 161397937) is carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one.
What is the SMILES notation for carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one?
The canonical SMILES for carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one is CON1C[C@@H](c2c(F)cc(C)cc2F)CC1=O.O=C=O.
What is the InChIKey of carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one?
The InChIKey is VTVVHIINXBOXDH-QRPNPIFTSA-N. The full InChI is InChI=1S/C12H13F2NO2.CO2/c1-7-3-9(13)12(10(14)4-7)8-5-11(16)15(6-8)17-2;2-1-3/h3-4,8H,5-6H2,1-2H3;/t8-;/m0./s1.
What are the key properties of carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one?
carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one has a molecular weight of 285.25 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;(4R)-4-(2,6-difluoro-4-methylphenyl)-1-methoxypyrrolidin-2-one is sourced from PubChem (CID 161397937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).