C53H41Cl4N3O7 — CID 161399121
2-[(2,6-dichlorobenzoyl)amino]-4-phenoxybenzoic acid;2,6-dichloro-N-(2-methyl-5-phenoxyphenyl)benzamide;2-methyl-5-phenoxyaniline (PubChem CID 161399121) has the molecular formula C53H41Cl4N3O7 and a molecular weight of 973.74 g/mol. Its IUPAC name is 2-[(2,6-dichlorobenzoyl)amino]-4-phenoxybenzoic acid;2,6-dichloro-N-(2-methyl-5-phenoxyphenyl)benzamide;2-methyl-5-phenoxyaniline.
| Compound Name | 2-[(2,6-dichlorobenzoyl)amino]-4-phenoxybenzoic acid;2,6-dichloro-N-(2-methyl-5-phenoxyphenyl)benzamide;2-methyl-5-phenoxyaniline |
|---|---|
| PubChem CID | 161399121 |
| Molecular Formula | C53H41Cl4N3O7 |
| Molecular Weight | 973.74 g/mol |
| Exact Mass | 971.17 |
| IUPAC Name | 2-[(2,6-dichlorobenzoyl)amino]-4-phenoxybenzoic acid;2,6-dichloro-N-(2-methyl-5-phenoxyphenyl)benzamide;2-methyl-5-phenoxyaniline |
| SMILES | Cc1ccc(Oc2ccccc2)cc1N.Cc1ccc(Oc2ccccc2)cc1NC(=O)c1c(Cl)cccc1Cl.O=C(O)c1ccc(Oc2ccccc2)cc1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H13Cl2NO4.C20H15Cl2NO2.C13H13NO/c21-15-7-4-8-16(22)18(15)19(24)23-17-11-13(9-10-14(17)20(25)26)27-12-5-2-1-3-6-12;1-13-10-11-15(25-14-6-3-2-4-7-14)12-18(13)23-20(24)19-16(21)8-5-9-17(19)22;1-10-7-8-12(9-13(10)14)15-11-5-3-2-4-6-11/h1-11H,(H,23,24)(H,25,26);2-12H,1H3,(H,23,24);2-9H,14H2,1H3 |
| InChIKey | VTZRFWVCDALUFF-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.74 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|