C28H32INO2 — CID 161400733
1-benzyl-3-[2-(4-iodophenyl)ethyl]indole-2-carboxylic acid;ethane (PubChem CID 161400733) has the molecular formula C28H32INO2 and a molecular weight of 541.47 g/mol. Its IUPAC name is 1-benzyl-3-[2-(4-iodophenyl)ethyl]indole-2-carboxylic acid;ethane.
| Compound Name | 1-benzyl-3-[2-(4-iodophenyl)ethyl]indole-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 161400733 |
| Molecular Formula | C28H32INO2 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1-benzyl-3-[2-(4-iodophenyl)ethyl]indole-2-carboxylic acid;ethane |
| SMILES | CC.CC.O=C(O)c1c(CCc2ccc(I)cc2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H20INO2.2C2H6/c25-19-13-10-17(11-14-19)12-15-21-20-8-4-5-9-22(20)26(23(21)24(27)28)16-18-6-2-1-3-7-18;2*1-2/h1-11,13-14H,12,15-16H2,(H,27,28);2*1-2H3 |
| InChIKey | VUEXMSFRXNSNED-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|