C35H40O7S — CID 161401597
[4-(4-methylphenyl)-1,1-dioxothian-4-yl] 2-methylprop-2-enoate;(4-naphthalen-1-yloxan-4-yl) 2-methylprop-2-enoate (PubChem CID 161401597) has the molecular formula C35H40O7S and a molecular weight of 604.77 g/mol. Its IUPAC name is [4-(4-methylphenyl)-1,1-dioxothian-4-yl] 2-methylprop-2-enoate;(4-naphthalen-1-yloxan-4-yl) 2-methylprop-2-enoate.
| Compound Name | [4-(4-methylphenyl)-1,1-dioxothian-4-yl] 2-methylprop-2-enoate;(4-naphthalen-1-yloxan-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161401597 |
| Molecular Formula | C35H40O7S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | [4-(4-methylphenyl)-1,1-dioxothian-4-yl] 2-methylprop-2-enoate;(4-naphthalen-1-yloxan-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(c2ccc(C)cc2)CCS(=O)(=O)CC1.C=C(C)C(=O)OC1(c2cccc3ccccc23)CCOCC1 |
| InChI | InChI=1S/C19H20O3.C16H20O4S/c1-14(2)18(20)22-19(10-12-21-13-11-19)17-9-5-7-15-6-3-4-8-16(15)17;1-12(2)15(17)20-16(8-10-21(18,19)11-9-16)14-6-4-13(3)5-7-14/h3-9H,1,10-13H2,2H3;4-7H,1,8-11H2,2-3H3 |
| InChIKey | VUHOWYRLYPCWNM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|