C18H35NO3 — CID 161402532
N,N-ditert-butyl-5-oxo-7-propoxyheptanamide (PubChem CID 161402532) has the molecular formula C18H35NO3 and a molecular weight of 313.48 g/mol. Its IUPAC name is N,N-ditert-butyl-5-oxo-7-propoxyheptanamide.
| Compound Name | N,N-ditert-butyl-5-oxo-7-propoxyheptanamide |
|---|---|
| PubChem CID | 161402532 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | N,N-ditert-butyl-5-oxo-7-propoxyheptanamide |
| SMILES | CCCOCCC(=O)CCCC(=O)N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H35NO3/c1-8-13-22-14-12-15(20)10-9-11-16(21)19(17(2,3)4)18(5,6)7/h8-14H2,1-7H3 |
| InChIKey | VUKOLHCVVAFGLW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|