C29H25ClN8O4 — CID 161411369
N-[(4-chloro-2-nitrophenyl)methyl]-1-methylindazol-5-amine;N-[(2-nitrophenyl)methyl]-1H-indazol-5-amine (PubChem CID 161411369) has the molecular formula C29H25ClN8O4 and a molecular weight of 585.02 g/mol. Its IUPAC name is N-[(4-chloro-2-nitrophenyl)methyl]-1-methylindazol-5-amine;N-[(2-nitrophenyl)methyl]-1H-indazol-5-amine.
| Compound Name | N-[(4-chloro-2-nitrophenyl)methyl]-1-methylindazol-5-amine;N-[(2-nitrophenyl)methyl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 161411369 |
| Molecular Formula | C29H25ClN8O4 |
| Molecular Weight | 585.02 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | N-[(4-chloro-2-nitrophenyl)methyl]-1-methylindazol-5-amine;N-[(2-nitrophenyl)methyl]-1H-indazol-5-amine |
| SMILES | Cn1ncc2cc(NCc3ccc(Cl)cc3[N+](=O)[O-])ccc21.O=[N+]([O-])c1ccccc1CNc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C15H13ClN4O2.C14H12N4O2/c1-19-14-5-4-13(6-11(14)9-18-19)17-8-10-2-3-12(16)7-15(10)20(21)22;19-18(20)14-4-2-1-3-10(14)8-15-12-5-6-13-11(7-12)9-16-17-13/h2-7,9,17H,8H2,1H3;1-7,9,15H,8H2,(H,16,17) |
| InChIKey | VVMYIOKEXCMWTR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.02 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|