About 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole
1-benzylindazol-5-amine;1-benzyl-5-nitroindazole (PubChem CID 70290415) has the molecular formula C28H24N6O2
and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole.
Molecular Properties
| Compound Name | 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole |
| PubChem CID | 70290415 |
| Molecular Formula | C28H24N6O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole |
| SMILES | Nc1ccc2c(cnn2Cc2ccccc2)c1.O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H11N3O2.C14H13N3/c18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11;15-13-6-7-14-12(8-13)9-16-17(14)10-11-4-2-1-3-5-11/h1-9H,10H2;1-9H,10,15H2 |
| InChIKey | MXUBFGQYIZXEOV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole?
The IUPAC name of 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole (CID 70290415) is 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole.
What is the SMILES notation for 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole?
The canonical SMILES for 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole is Nc1ccc2c(cnn2Cc2ccccc2)c1.O=[N+]([O-])c1ccc2c(cnn2Cc2ccccc2)c1.
What is the InChIKey of 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole?
The InChIKey is MXUBFGQYIZXEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2.C14H13N3/c18-17(19)13-6-7-14-12(8-13)9-15-16(14)10-11-4-2-1-3-5-11;15-13-6-7-14-12(8-13)9-16-17(14)10-11-4-2-1-3-5-11/h1-9H,10H2;1-9H,10,15H2.
What are the key properties of 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole?
1-benzylindazol-5-amine;1-benzyl-5-nitroindazole has a molecular weight of 476.54 g/mol, XLogP of 5.66, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylindazol-5-amine;1-benzyl-5-nitroindazole is sourced from PubChem (CID 70290415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).