C39H36N4O2 — CID 161412266
2-[[2-[(9-butyl-3-hydroxy-7-methylcarbazol-2-yl)methylideneamino]phenyl]iminomethyl]-7,9-dimethylcarbazol-3-ol (PubChem CID 161412266) has the molecular formula C39H36N4O2 and a molecular weight of 592.74 g/mol. Its IUPAC name is 2-[[2-[(9-butyl-3-hydroxy-7-methylcarbazol-2-yl)methylideneamino]phenyl]iminomethyl]-7,9-dimethylcarbazol-3-ol.
| Compound Name | 2-[[2-[(9-butyl-3-hydroxy-7-methylcarbazol-2-yl)methylideneamino]phenyl]iminomethyl]-7,9-dimethylcarbazol-3-ol |
|---|---|
| PubChem CID | 161412266 |
| Molecular Formula | C39H36N4O2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-[[2-[(9-butyl-3-hydroxy-7-methylcarbazol-2-yl)methylideneamino]phenyl]iminomethyl]-7,9-dimethylcarbazol-3-ol |
| SMILES | CCCCn1c2cc(C)ccc2c2cc(O)c(/C=N/c3ccccc3/N=C/c3cc4c(cc3O)c3ccc(C)cc3n4C)cc21 |
| InChI | InChI=1S/C39H36N4O2/c1-5-6-15-43-36-17-25(3)12-14-29(36)31-21-39(45)27(19-37(31)43)23-41-33-10-8-7-9-32(33)40-22-26-18-35-30(20-38(26)44)28-13-11-24(2)16-34(28)42(35)4/h7-14,16-23,44-45H,5-6,15H2,1-4H3/b40-22+,41-23+ |
| InChIKey | BVLPTTLZTYOYRM-SKPVJXRPSA-N |
| XLogP | 9.77 |
| TPSA | 75.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|