C41H40N4O2 — CID 140908952
9-butyl-2-[[2-[(9-butyl-3-hydroxycarbazol-2-yl)methylideneamino]-4-methylphenyl]iminomethyl]carbazol-3-ol (PubChem CID 140908952) has the molecular formula C41H40N4O2 and a molecular weight of 620.80 g/mol. Its IUPAC name is 9-butyl-2-[[2-[(9-butyl-3-hydroxycarbazol-2-yl)methylideneamino]-4-methylphenyl]iminomethyl]carbazol-3-ol.
| Compound Name | 9-butyl-2-[[2-[(9-butyl-3-hydroxycarbazol-2-yl)methylideneamino]-4-methylphenyl]iminomethyl]carbazol-3-ol |
|---|---|
| PubChem CID | 140908952 |
| Molecular Formula | C41H40N4O2 |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | 9-butyl-2-[[2-[(9-butyl-3-hydroxycarbazol-2-yl)methylideneamino]-4-methylphenyl]iminomethyl]carbazol-3-ol |
| SMILES | CCCCn1c2ccccc2c2cc(O)c(/C=N/c3ccc(C)cc3/N=C/c3cc4c(cc3O)c3ccccc3n4CCCC)cc21 |
| InChI | InChI=1S/C41H40N4O2/c1-4-6-18-44-36-14-10-8-12-30(36)32-23-40(46)28(21-38(32)44)25-42-34-17-16-27(3)20-35(34)43-26-29-22-39-33(24-41(29)47)31-13-9-11-15-37(31)45(39)19-7-5-2/h8-17,20-26,46-47H,4-7,18-19H2,1-3H3/b42-25+,43-26+ |
| InChIKey | NQBCSOYYZVTFQX-DCRHPOARSA-N |
| XLogP | 10.72 |
| TPSA | 75.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|