C27H23F3N6O7S — CID 161413986
methyl 4-(methylamino)-3-nitrobenzoate;methyl 1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate (PubChem CID 161413986) has the molecular formula C27H23F3N6O7S and a molecular weight of 632.58 g/mol. Its IUPAC name is methyl 4-(methylamino)-3-nitrobenzoate;methyl 1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate.
| Compound Name | methyl 4-(methylamino)-3-nitrobenzoate;methyl 1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 161413986 |
| Molecular Formula | C27H23F3N6O7S |
| Molecular Weight | 632.58 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | methyl 4-(methylamino)-3-nitrobenzoate;methyl 1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylate |
| SMILES | CNc1ccc(C(=O)OC)cc1[N+](=O)[O-].COC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C |
| InChI | InChI=1S/C18H13F3N4O3S.C9H10N2O4/c1-25-13-6-3-9(15(26)27-2)7-12(13)22-16(25)24-17-23-11-5-4-10(8-14(11)29-17)28-18(19,20)21;1-10-7-4-3-6(9(12)15-2)5-8(7)11(13)14/h3-8H,1-2H3,(H,22,23,24);3-5,10H,1-2H3 |
| InChIKey | VVVLGWJOORJQOG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|