About (2R)-1,1-difluorohex-5-ene-2-sulfonamide
(2R)-1,1-difluorohex-5-ene-2-sulfonamide (PubChem CID 161414952) has the molecular formula C6H11F2NO2S
and a molecular weight of 199.22 g/mol. Its IUPAC name is (2R)-1,1-difluorohex-5-ene-2-sulfonamide.
Molecular Properties
| Compound Name | (2R)-1,1-difluorohex-5-ene-2-sulfonamide |
| PubChem CID | 161414952 |
| Molecular Formula | C6H11F2NO2S |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | (2R)-1,1-difluorohex-5-ene-2-sulfonamide |
| SMILES | C=CCC[C@H](C(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C6H11F2NO2S/c1-2-3-4-5(6(7)8)12(9,10)11/h2,5-6H,1,3-4H2,(H2,9,10,11)/t5-/m1/s1 |
| InChIKey | XVPMOPAACAYOPX-RXMQYKEDSA-N |
| XLogP | 0.87 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,1-difluorohex-5-ene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1-difluorohex-5-ene-2-sulfonamide?
The IUPAC name of (2R)-1,1-difluorohex-5-ene-2-sulfonamide (CID 161414952) is (2R)-1,1-difluorohex-5-ene-2-sulfonamide.
What is the SMILES notation for (2R)-1,1-difluorohex-5-ene-2-sulfonamide?
The canonical SMILES for (2R)-1,1-difluorohex-5-ene-2-sulfonamide is C=CCC[C@H](C(F)F)S(N)(=O)=O.
What is the InChIKey of (2R)-1,1-difluorohex-5-ene-2-sulfonamide?
The InChIKey is XVPMOPAACAYOPX-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H11F2NO2S/c1-2-3-4-5(6(7)8)12(9,10)11/h2,5-6H,1,3-4H2,(H2,9,10,11)/t5-/m1/s1.
What are the key properties of (2R)-1,1-difluorohex-5-ene-2-sulfonamide?
(2R)-1,1-difluorohex-5-ene-2-sulfonamide has a molecular weight of 199.22 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1-difluorohex-5-ene-2-sulfonamide is sourced from PubChem (CID 161414952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).