C21H18Cl3F3N2O3S — CID 161442363
4-[3-methyl-5-[(5S)-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]thiophen-2-yl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 161442363) has the molecular formula C21H18Cl3F3N2O3S and a molecular weight of 541.81 g/mol. Its IUPAC name is 4-[3-methyl-5-[(5S)-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]thiophen-2-yl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-[3-methyl-5-[(5S)-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]thiophen-2-yl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 161442363 |
| Molecular Formula | C21H18Cl3F3N2O3S |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 540.01 |
| IUPAC Name | 4-[3-methyl-5-[(5S)-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]thiophen-2-yl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | Cc1cc(C2=NO[C@](C)(c3cc(Cl)c(Cl)c(Cl)c3)C2)sc1C(=O)CCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C21H18Cl3F3N2O3S/c1-10-5-16(33-19(10)15(30)3-4-17(31)28-9-21(25,26)27)14-8-20(2,32-29-14)11-6-12(22)18(24)13(23)7-11/h5-7H,3-4,8-9H2,1-2H3,(H,28,31)/t20-/m0/s1 |
| InChIKey | VZLFVWRCNNHCLG-FQEVSTJZSA-N |
| XLogP | 6.70 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|