C25H29NO6 — CID 161442493
3,4-dimethoxybenzaldehyde;2-[(3,4-dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 161442493) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3,4-dimethoxybenzaldehyde;2-[(3,4-dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | 3,4-dimethoxybenzaldehyde;2-[(3,4-dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 161442493 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3,4-dimethoxybenzaldehyde;2-[(3,4-dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | COc1ccc(C=C2C(=O)C3CCN2CC3)cc1OC.COc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C16H19NO3.C9H10O3/c1-19-14-4-3-11(10-15(14)20-2)9-13-16(18)12-5-7-17(13)8-6-12;1-11-8-4-3-7(6-10)5-9(8)12-2/h3-4,9-10,12H,5-8H2,1-2H3;3-6H,1-2H3 |
| InChIKey | VZLPJJBYDXIURF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|