C22H32N6O4S — CID 161446487
4-(cyclopropylamino)-2-[[(3S)-3-(2-propan-2-yloxyethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide;sulfane (PubChem CID 161446487) has the molecular formula C22H32N6O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 4-(cyclopropylamino)-2-[[(3S)-3-(2-propan-2-yloxyethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide;sulfane.
| Compound Name | 4-(cyclopropylamino)-2-[[(3S)-3-(2-propan-2-yloxyethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide;sulfane |
|---|---|
| PubChem CID | 161446487 |
| Molecular Formula | C22H32N6O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 4-(cyclopropylamino)-2-[[(3S)-3-(2-propan-2-yloxyethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide;sulfane |
| SMILES | CC(C)OCCO[C@H]1CNc2cc(Nc3ncc(C(N)=O)c(NC4CC4)n3)ccc2OC1.S |
| InChI | InChI=1S/C22H30N6O4.H2S/c1-13(2)30-7-8-31-16-10-24-18-9-15(5-6-19(18)32-12-16)27-22-25-11-17(20(23)29)21(28-22)26-14-3-4-14;/h5-6,9,11,13-14,16,24H,3-4,7-8,10,12H2,1-2H3,(H2,23,29)(H2,25,26,27,28);1H2/t16-;/m0./s1 |
| InChIKey | VZYPAMFDMXQZOD-NTISSMGPSA-N |
| XLogP | 2.62 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|