C23H32N6O3 — CID 152813912
4-(cyclopropylamino)-2-[[(3R)-3-methyl-3-pentoxy-4,5-dihydro-2H-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide (PubChem CID 152813912) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-(cyclopropylamino)-2-[[(3R)-3-methyl-3-pentoxy-4,5-dihydro-2H-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclopropylamino)-2-[[(3R)-3-methyl-3-pentoxy-4,5-dihydro-2H-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 152813912 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 4-(cyclopropylamino)-2-[[(3R)-3-methyl-3-pentoxy-4,5-dihydro-2H-1,5-benzoxazepin-7-yl]amino]pyrimidine-5-carboxamide |
| SMILES | CCCCCO[C@]1(C)CNc2cc(Nc3ncc(C(N)=O)c(NC4CC4)n3)ccc2OC1 |
| InChI | InChI=1S/C23H32N6O3/c1-3-4-5-10-32-23(2)13-26-18-11-16(8-9-19(18)31-14-23)28-22-25-12-17(20(24)30)21(29-22)27-15-6-7-15/h8-9,11-12,15,26H,3-7,10,13-14H2,1-2H3,(H2,24,30)(H2,25,27,28,29)/t23-/m1/s1 |
| InChIKey | SRZRPHINPIBTBV-HSZRJFAPSA-N |
| XLogP | 3.66 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|