C33H36Cl2FN3O5S2 — CID 161451054
(2S,6S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-6-[[3-[(3-fluoro-2,3,4,5-tetrahydropyridin-6-yl)methyl]benzoyl]amino]-5-oxoheptanoic acid;sulfane (PubChem CID 161451054) has the molecular formula C33H36Cl2FN3O5S2 and a molecular weight of 708.71 g/mol. Its IUPAC name is (2S,6S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-6-[[3-[(3-fluoro-2,3,4,5-tetrahydropyridin-6-yl)methyl]benzoyl]amino]-5-oxoheptanoic acid;sulfane.
| Compound Name | (2S,6S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-6-[[3-[(3-fluoro-2,3,4,5-tetrahydropyridin-6-yl)methyl]benzoyl]amino]-5-oxoheptanoic acid;sulfane |
|---|---|
| PubChem CID | 161451054 |
| Molecular Formula | C33H36Cl2FN3O5S2 |
| Molecular Weight | 708.71 g/mol |
| Exact Mass | 707.15 |
| IUPAC Name | (2S,6S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-6-[[3-[(3-fluoro-2,3,4,5-tetrahydropyridin-6-yl)methyl]benzoyl]amino]-5-oxoheptanoic acid;sulfane |
| SMILES | C[C@H](NC(=O)c1cccc(CC2=NCC(F)CC2)c1)C(=O)CC[C@H](NC(=O)c1c(Cl)cc(-c2ccccc2)cc1Cl)C(=O)O.S.S |
| InChI | InChI=1S/C33H32Cl2FN3O5.2H2S/c1-19(38-31(41)22-9-5-6-20(14-22)15-25-11-10-24(36)18-37-25)29(40)13-12-28(33(43)44)39-32(42)30-26(34)16-23(17-27(30)35)21-7-3-2-4-8-21;;/h2-9,14,16-17,19,24,28H,10-13,15,18H2,1H3,(H,38,41)(H,39,42)(H,43,44);2*1H2/t19-,24?,28-;;/m0../s1 |
| InChIKey | WANMWHUEJZFBOS-FEXRMBJZSA-N |
| XLogP | 6.35 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |