C23H27F3N4 — CID 161467811
2-tert-butyl-6-methyl-1H-benzimidazole;2-tert-butyl-4,5,6-trifluoro-1H-benzimidazole (PubChem CID 161467811) has the molecular formula C23H27F3N4 and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-tert-butyl-6-methyl-1H-benzimidazole;2-tert-butyl-4,5,6-trifluoro-1H-benzimidazole.
| Compound Name | 2-tert-butyl-6-methyl-1H-benzimidazole;2-tert-butyl-4,5,6-trifluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 161467811 |
| Molecular Formula | C23H27F3N4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-tert-butyl-6-methyl-1H-benzimidazole;2-tert-butyl-4,5,6-trifluoro-1H-benzimidazole |
| SMILES | CC(C)(C)c1nc2c(F)c(F)c(F)cc2[nH]1.Cc1ccc2nc(C(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C12H16N2.C11H11F3N2/c1-8-5-6-9-10(7-8)14-11(13-9)12(2,3)4;1-11(2,3)10-15-6-4-5(12)7(13)8(14)9(6)16-10/h5-7H,1-4H3,(H,13,14);4H,1-3H3,(H,15,16) |
| InChIKey | WCRDRPOGTYSNBS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|