C31H39ClN2O4 — CID 161470422
N-ethyl-4-methoxy-3-(3-methoxypropoxy)-N-[(4R)-4-(3-phenylphenyl)piperidin-3-yl]benzamide;hydrochloride (PubChem CID 161470422) has the molecular formula C31H39ClN2O4 and a molecular weight of 539.12 g/mol. Its IUPAC name is N-ethyl-4-methoxy-3-(3-methoxypropoxy)-N-[(4R)-4-(3-phenylphenyl)piperidin-3-yl]benzamide;hydrochloride.
| Compound Name | N-ethyl-4-methoxy-3-(3-methoxypropoxy)-N-[(4R)-4-(3-phenylphenyl)piperidin-3-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 161470422 |
| Molecular Formula | C31H39ClN2O4 |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | N-ethyl-4-methoxy-3-(3-methoxypropoxy)-N-[(4R)-4-(3-phenylphenyl)piperidin-3-yl]benzamide;hydrochloride |
| SMILES | CCN(C(=O)c1ccc(OC)c(OCCCOC)c1)C1CNCC[C@@H]1c1cccc(-c2ccccc2)c1.Cl |
| InChI | InChI=1S/C31H38N2O4.ClH/c1-4-33(31(34)26-14-15-29(36-3)30(21-26)37-19-9-18-35-2)28-22-32-17-16-27(28)25-13-8-12-24(20-25)23-10-6-5-7-11-23;/h5-8,10-15,20-21,27-28,32H,4,9,16-19,22H2,1-3H3;1H/t27-,28?;/m1./s1 |
| InChIKey | BJDQVBPCFFDKPX-RTJZFNRYSA-N |
| XLogP | 5.81 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|