C6H18N3O4P — CID 161473833
[(2-aminoacetyl)amino]methylphosphonic acid;propan-2-amine (PubChem CID 161473833) has the molecular formula C6H18N3O4P and a molecular weight of 227.20 g/mol. Its IUPAC name is [(2-aminoacetyl)amino]methylphosphonic acid;propan-2-amine.
| Compound Name | [(2-aminoacetyl)amino]methylphosphonic acid;propan-2-amine |
|---|---|
| PubChem CID | 161473833 |
| Molecular Formula | C6H18N3O4P |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | [(2-aminoacetyl)amino]methylphosphonic acid;propan-2-amine |
| SMILES | CC(C)N.NCC(=O)NCP(=O)(O)O |
| InChI | InChI=1S/C3H9N2O4P.C3H9N/c4-1-3(6)5-2-10(7,8)9;1-3(2)4/h1-2,4H2,(H,5,6)(H2,7,8,9);3H,4H2,1-2H3 |
| InChIKey | WDLFUTPXNTVBCS-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|