C22H32FN5O2 — CID 161473929
N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide;methane (PubChem CID 161473929) has the molecular formula C22H32FN5O2 and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide;methane.
| Compound Name | N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide;methane |
|---|---|
| PubChem CID | 161473929 |
| Molecular Formula | C22H32FN5O2 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-[3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]-8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide;methane |
| SMILES | C.CNC(=O)C(NC(=O)c1nc(-c2ccccc2)n2c1CN(C)CCC2)C(C)(C)F |
| InChI | InChI=1S/C21H28FN5O2.CH4/c1-21(2,22)17(20(29)23-3)25-19(28)16-15-13-26(4)11-8-12-27(15)18(24-16)14-9-6-5-7-10-14;/h5-7,9-10,17H,8,11-13H2,1-4H3,(H,23,29)(H,25,28);1H4 |
| InChIKey | WDLPQOVWKFYLPD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |