C23H32N4O2 — CID 58135726
(2S)-N,3,3-trimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanamide (PubChem CID 58135726) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (2S)-N,3,3-trimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanamide.
| Compound Name | (2S)-N,3,3-trimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 58135726 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (2S)-N,3,3-trimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2)n2c1CN(C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C23H32N4O2/c1-23(2,3)17(22(29)24-4)14-19(28)20-18-15-26(5)12-9-13-27(18)21(25-20)16-10-7-6-8-11-16/h6-8,10-11,17H,9,12-15H2,1-5H3,(H,24,29)/t17-/m1/s1 |
| InChIKey | NJVPHKDMSDDTIX-QGZVFWFLSA-N |
| XLogP | 3.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |